C13H19BrN2O2 — CID 69234723
tert-butyl N-[2-(4-bromoanilino)ethyl]carbamate (PubChem CID 69234723) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is tert-butyl N-[2-(4-bromoanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-bromoanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 69234723 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | tert-butyl N-[2-(4-bromoanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H19BrN2O2/c1-13(2,3)18-12(17)16-9-8-15-11-6-4-10(14)5-7-11/h4-7,15H,8-9H2,1-3H3,(H,16,17) |
| InChIKey | NKBDWGYIUJBUNZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|