C12H18BrN3O2 — CID 103949623
tert-butyl N-[2-[(6-bromo-3-pyridinyl)amino]ethyl]carbamate (PubChem CID 103949623) has the molecular formula C12H18BrN3O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is tert-butyl N-[2-[(6-bromo-3-pyridinyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(6-bromo-3-pyridinyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 103949623 |
| Molecular Formula | C12H18BrN3O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | tert-butyl N-[2-[(6-bromo-3-pyridinyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(Br)nc1 |
| InChI | InChI=1S/C12H18BrN3O2/c1-12(2,3)18-11(17)15-7-6-14-9-4-5-10(13)16-8-9/h4-5,8,14H,6-7H2,1-3H3,(H,15,17) |
| InChIKey | ZKWMYWVFIFGRSN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|