C14H21BrN2O4 — CID 171885899
tert-butyl N-[4-(6-bromo-3-pyridinyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171885899) has the molecular formula C14H21BrN2O4 and a molecular weight of 361.24 g/mol. Its IUPAC name is tert-butyl N-[4-(6-bromo-3-pyridinyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(6-bromo-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171885899 |
| Molecular Formula | C14H21BrN2O4 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | tert-butyl N-[4-(6-bromo-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1ccc(Br)nc1 |
| InChI | InChI=1S/C14H21BrN2O4/c1-14(2,3)21-13(20)16-7-6-10(18)12(19)9-4-5-11(15)17-8-9/h4-5,8,10,12,18-19H,6-7H2,1-3H3,(H,16,20) |
| InChIKey | SJBRDPSNVIKQOB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|