C17H27NO4 — CID 171884388
tert-butyl N-[4-(3,5-dimethylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884388) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl N-[4-(3,5-dimethylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(3,5-dimethylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884388 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | tert-butyl N-[4-(3,5-dimethylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Cc1cc(C)cc(C(O)C(O)CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H27NO4/c1-11-8-12(2)10-13(9-11)15(20)14(19)6-7-18-16(21)22-17(3,4)5/h8-10,14-15,19-20H,6-7H2,1-5H3,(H,18,21) |
| InChIKey | DVRJDAMFFDKKDY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |