C16H22FNO5 — CID 171884760
tert-butyl N-[4-(3-fluoro-5-formylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884760) has the molecular formula C16H22FNO5 and a molecular weight of 327.35 g/mol. Its IUPAC name is tert-butyl N-[4-(3-fluoro-5-formylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-fluoro-5-formylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884760 |
| Molecular Formula | C16H22FNO5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | tert-butyl N-[4-(3-fluoro-5-formylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1cc(F)cc(C=O)c1 |
| InChI | InChI=1S/C16H22FNO5/c1-16(2,3)23-15(22)18-5-4-13(20)14(21)11-6-10(9-19)7-12(17)8-11/h6-9,13-14,20-21H,4-5H2,1-3H3,(H,18,22) |
| InChIKey | KQYVXYDDQFRKRJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|