C15H20Cl2FNO4 — CID 171884666
tert-butyl N-[4-(3,4-dichloro-5-fluorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884666) has the molecular formula C15H20Cl2FNO4 and a molecular weight of 368.23 g/mol. Its IUPAC name is tert-butyl N-[4-(3,4-dichloro-5-fluorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(3,4-dichloro-5-fluorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884666 |
| Molecular Formula | C15H20Cl2FNO4 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | tert-butyl N-[4-(3,4-dichloro-5-fluorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1cc(F)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2FNO4/c1-15(2,3)23-14(22)19-5-4-11(20)13(21)8-6-9(16)12(17)10(18)7-8/h6-7,11,13,20-21H,4-5H2,1-3H3,(H,19,22) |
| InChIKey | ZKSKOMBTEMSSGO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|