C17H24ClNO5 — CID 171885168
tert-butyl N-[4-(4-acetyl-3-chlorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171885168) has the molecular formula C17H24ClNO5 and a molecular weight of 357.83 g/mol. Its IUPAC name is tert-butyl N-[4-(4-acetyl-3-chlorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-acetyl-3-chlorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171885168 |
| Molecular Formula | C17H24ClNO5 |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | tert-butyl N-[4-(4-acetyl-3-chlorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(=O)c1ccc(C(O)C(O)CCNC(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C17H24ClNO5/c1-10(20)12-6-5-11(9-13(12)18)15(22)14(21)7-8-19-16(23)24-17(2,3)4/h5-6,9,14-15,21-22H,7-8H2,1-4H3,(H,19,23) |
| InChIKey | ABSKSATXPGJWNL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |