C18H29NO4 — CID 171884677
tert-butyl N-[3,4-dihydroxy-4-(4-propan-2-ylphenyl)butyl]carbamate (PubChem CID 171884677) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is tert-butyl N-[3,4-dihydroxy-4-(4-propan-2-ylphenyl)butyl]carbamate.
| Compound Name | tert-butyl N-[3,4-dihydroxy-4-(4-propan-2-ylphenyl)butyl]carbamate |
|---|---|
| PubChem CID | 171884677 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | tert-butyl N-[3,4-dihydroxy-4-(4-propan-2-ylphenyl)butyl]carbamate |
| SMILES | CC(C)c1ccc(C(O)C(O)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H29NO4/c1-12(2)13-6-8-14(9-7-13)16(21)15(20)10-11-19-17(22)23-18(3,4)5/h6-9,12,15-16,20-21H,10-11H2,1-5H3,(H,19,22) |
| InChIKey | BDKBPGHEBVADDW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |