C19H27NO7 — CID 171885794
ethyl 2-[4-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenyl]-2-oxoacetate (PubChem CID 171885794) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl 2-[4-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenyl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 171885794 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | ethyl 2-[4-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1ccc(C(O)C(O)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H27NO7/c1-5-26-17(24)16(23)13-8-6-12(7-9-13)15(22)14(21)10-11-20-18(25)27-19(2,3)4/h6-9,14-15,21-22H,5,10-11H2,1-4H3,(H,20,25) |
| InChIKey | PJPTUYADVCYYEO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|