C14H23N3O4 — CID 171884300
tert-butyl N-[4-(2-amino-4-pyridinyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884300) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is tert-butyl N-[4-(2-amino-4-pyridinyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-amino-4-pyridinyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884300 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | tert-butyl N-[4-(2-amino-4-pyridinyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1ccnc(N)c1 |
| InChI | InChI=1S/C14H23N3O4/c1-14(2,3)21-13(20)17-7-5-10(18)12(19)9-4-6-16-11(15)8-9/h4,6,8,10,12,18-19H,5,7H2,1-3H3,(H2,15,16)(H,17,20) |
| InChIKey | FVACMIIFDHKWGD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |