C16H25NO6S — CID 171885097
tert-butyl N-[3,4-dihydroxy-4-(3-methylsulfonylphenyl)butyl]carbamate (PubChem CID 171885097) has the molecular formula C16H25NO6S and a molecular weight of 359.44 g/mol. Its IUPAC name is tert-butyl N-[3,4-dihydroxy-4-(3-methylsulfonylphenyl)butyl]carbamate.
| Compound Name | tert-butyl N-[3,4-dihydroxy-4-(3-methylsulfonylphenyl)butyl]carbamate |
|---|---|
| PubChem CID | 171885097 |
| Molecular Formula | C16H25NO6S |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | tert-butyl N-[3,4-dihydroxy-4-(3-methylsulfonylphenyl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H25NO6S/c1-16(2,3)23-15(20)17-9-8-13(18)14(19)11-6-5-7-12(10-11)24(4,21)22/h5-7,10,13-14,18-19H,8-9H2,1-4H3,(H,17,20) |
| InChIKey | GXUPQDXUOCPQEN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |