C14H22N2O6S — CID 170832544
tert-butyl N-[2,3-dihydroxy-3-(3-sulfamoylphenyl)propyl]carbamate (PubChem CID 170832544) has the molecular formula C14H22N2O6S and a molecular weight of 346.41 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydroxy-3-(3-sulfamoylphenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydroxy-3-(3-sulfamoylphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 170832544 |
| Molecular Formula | C14H22N2O6S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | tert-butyl N-[2,3-dihydroxy-3-(3-sulfamoylphenyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H22N2O6S/c1-14(2,3)22-13(19)16-8-11(17)12(18)9-5-4-6-10(7-9)23(15,20)21/h4-7,11-12,17-18H,8H2,1-3H3,(H,16,19)(H2,15,20,21) |
| InChIKey | IGEPBMMFEDFBJV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |