C9H12ClNO4S — CID 171862462
3-(3-chloro-1,2-dihydroxypropyl)benzenesulfonamide (PubChem CID 171862462) has the molecular formula C9H12ClNO4S and a molecular weight of 265.72 g/mol. Its IUPAC name is 3-(3-chloro-1,2-dihydroxypropyl)benzenesulfonamide.
| Compound Name | 3-(3-chloro-1,2-dihydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 171862462 |
| Molecular Formula | C9H12ClNO4S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 3-(3-chloro-1,2-dihydroxypropyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(C(O)C(O)CCl)c1 |
| InChI | InChI=1S/C9H12ClNO4S/c10-5-8(12)9(13)6-2-1-3-7(4-6)16(11,14)15/h1-4,8-9,12-13H,5H2,(H2,11,14,15) |
| InChIKey | ADTZSQRBKBZYKX-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|