C9H11NO6S — CID 170824386
2,3-dihydroxy-3-(3-sulfamoylphenyl)propanoic acid (PubChem CID 170824386) has the molecular formula C9H11NO6S and a molecular weight of 261.25 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(3-sulfamoylphenyl)propanoic acid.
| Compound Name | 2,3-dihydroxy-3-(3-sulfamoylphenyl)propanoic acid |
|---|---|
| PubChem CID | 170824386 |
| Molecular Formula | C9H11NO6S |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2,3-dihydroxy-3-(3-sulfamoylphenyl)propanoic acid |
| SMILES | NS(=O)(=O)c1cccc(C(O)C(O)C(=O)O)c1 |
| InChI | InChI=1S/C9H11NO6S/c10-17(15,16)6-3-1-2-5(4-6)7(11)8(12)9(13)14/h1-4,7-8,11-12H,(H,13,14)(H2,10,15,16) |
| InChIKey | WNTVNDVQJPCVOL-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |