C16H20N3O4S+ — CID 9170013
[(2R)-2-hydroxy-2-phenylethyl]-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium (PubChem CID 9170013) has the molecular formula C16H20N3O4S+ and a molecular weight of 350.42 g/mol. Its IUPAC name is [(2R)-2-hydroxy-2-phenylethyl]-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium.
| Compound Name | [(2R)-2-hydroxy-2-phenylethyl]-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9170013 |
| Molecular Formula | C16H20N3O4S+ |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [(2R)-2-hydroxy-2-phenylethyl]-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)C[NH2+]C[C@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H19N3O4S/c17-24(22,23)14-8-4-7-13(9-14)19-16(21)11-18-10-15(20)12-5-2-1-3-6-12/h1-9,15,18,20H,10-11H2,(H,19,21)(H2,17,22,23)/p+1/t15-/m0/s1 |
| InChIKey | XGLYHJSFTUBTRL-HNNXBMFYSA-O |
| XLogP | -0.43 |
| TPSA | 126.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |