C19H25N2O3S+ — CID 9133093
[(1R)-2-methyl-1-phenylpropyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium (PubChem CID 9133093) has the molecular formula C19H25N2O3S+ and a molecular weight of 361.49 g/mol. Its IUPAC name is [(1R)-2-methyl-1-phenylpropyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-2-methyl-1-phenylpropyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9133093 |
| Molecular Formula | C19H25N2O3S+ |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [(1R)-2-methyl-1-phenylpropyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+]CC(=O)Nc1cccc(S(C)(=O)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O3S/c1-14(2)19(15-8-5-4-6-9-15)20-13-18(22)21-16-10-7-11-17(12-16)25(3,23)24/h4-12,14,19-20H,13H2,1-3H3,(H,21,22)/p+1/t19-/m1/s1 |
| InChIKey | MSLGMDKXKWOCBV-LJQANCHMSA-O |
| XLogP | 1.99 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |