C16H18BrN2O+ — CID 2684071
[2-(3-bromoanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium (PubChem CID 2684071) has the molecular formula C16H18BrN2O+ and a molecular weight of 334.24 g/mol. Its IUPAC name is [2-(3-bromoanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [2-(3-bromoanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 2684071 |
| Molecular Formula | C16H18BrN2O+ |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | [2-(3-bromoanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1cccc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C16H17BrN2O/c1-12(13-6-3-2-4-7-13)18-11-16(20)19-15-9-5-8-14(17)10-15/h2-10,12,18H,11H2,1H3,(H,19,20)/p+1/t12-/m1/s1 |
| InChIKey | IPZCNIJJXOALIN-GFCCVEGCSA-O |
| XLogP | 2.71 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |