C16H16BrF2N2O+ — CID 9369623
[2-(3-bromoanilino)-2-oxoethyl]-[(1R)-1-(2,4-difluorophenyl)ethyl]azanium (PubChem CID 9369623) has the molecular formula C16H16BrF2N2O+ and a molecular weight of 370.22 g/mol. Its IUPAC name is [2-(3-bromoanilino)-2-oxoethyl]-[(1R)-1-(2,4-difluorophenyl)ethyl]azanium.
| Compound Name | [2-(3-bromoanilino)-2-oxoethyl]-[(1R)-1-(2,4-difluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9369623 |
| Molecular Formula | C16H16BrF2N2O+ |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | [2-(3-bromoanilino)-2-oxoethyl]-[(1R)-1-(2,4-difluorophenyl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1cccc(Br)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H15BrF2N2O/c1-10(14-6-5-12(18)8-15(14)19)20-9-16(22)21-13-4-2-3-11(17)7-13/h2-8,10,20H,9H2,1H3,(H,21,22)/p+1/t10-/m1/s1 |
| InChIKey | AJXQFNIFEVBXRE-SNVBAGLBSA-O |
| XLogP | 2.99 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |