C18H20ClN2O2+ — CID 9335434
[2-(3-acetylanilino)-2-oxoethyl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium (PubChem CID 9335434) has the molecular formula C18H20ClN2O2+ and a molecular weight of 331.82 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9335434 |
| Molecular Formula | C18H20ClN2O2+ |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium |
| SMILES | CC(=O)c1cccc(NC(=O)C[NH2+][C@@H](C)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H19ClN2O2/c1-12(14-6-8-16(19)9-7-14)20-11-18(23)21-17-5-3-4-15(10-17)13(2)22/h3-10,12,20H,11H2,1-2H3,(H,21,23)/p+1/t12-/m0/s1 |
| InChIKey | YKWGILRYUSBKOP-LBPRGKRZSA-O |
| XLogP | 2.81 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |