C24H25N2O2+ — CID 9392545
[2-(3-acetylanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium (PubChem CID 9392545) has the molecular formula C24H25N2O2+ and a molecular weight of 373.48 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 9392545 |
| Molecular Formula | C24H25N2O2+ |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
| SMILES | CC(=O)c1cccc(NC(=O)C[NH2+][C@@H](c2ccccc2)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H24N2O2/c1-17-11-13-20(14-12-17)24(19-7-4-3-5-8-19)25-16-23(28)26-22-10-6-9-21(15-22)18(2)27/h3-15,24-25H,16H2,1-2H3,(H,26,28)/p+1/t24-/m0/s1 |
| InChIKey | RTESEJWOVPAGOT-DEOSSOPVSA-O |
| XLogP | 3.49 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |