C24H26N3O2+ — CID 8641344
[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium (PubChem CID 8641344) has the molecular formula C24H26N3O2+ and a molecular weight of 388.49 g/mol. Its IUPAC name is [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium.
| Compound Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 8641344 |
| Molecular Formula | C24H26N3O2+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
| SMILES | CNC(=O)c1cccc(NC(=O)C[NH2+][C@@H](c2ccccc2)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-17-11-13-19(14-12-17)23(18-7-4-3-5-8-18)26-16-22(28)27-21-10-6-9-20(15-21)24(29)25-2/h3-15,23,26H,16H2,1-2H3,(H,25,29)(H,27,28)/p+1/t23-/m0/s1 |
| InChIKey | HGUMSKYLZFIXMS-QHCPKHFHSA-O |
| XLogP | 2.65 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |