C23H22N3O+ — CID 9393047
[2-(4-cyanoanilino)-2-oxoethyl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium (PubChem CID 9393047) has the molecular formula C23H22N3O+ and a molecular weight of 356.45 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 9393047 |
| Molecular Formula | C23H22N3O+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium |
| SMILES | Cc1ccc([C@H]([NH2+]CC(=O)Nc2ccc(C#N)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O/c1-17-7-11-20(12-8-17)23(19-5-3-2-4-6-19)25-16-22(27)26-21-13-9-18(15-24)10-14-21/h2-14,23,25H,16H2,1H3,(H,26,27)/p+1/t23-/m1/s1 |
| InChIKey | FYYUTCNHVNFBAZ-HSZRJFAPSA-O |
| XLogP | 3.16 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |