C19H25N3O2 — CID 142563467
N'-(4-cyanophenyl)-N-(4-methylphenyl)propanediamide;ethane;molecular hydrogen (PubChem CID 142563467) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N'-(4-cyanophenyl)-N-(4-methylphenyl)propanediamide;ethane;molecular hydrogen.
| Compound Name | N'-(4-cyanophenyl)-N-(4-methylphenyl)propanediamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 142563467 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N'-(4-cyanophenyl)-N-(4-methylphenyl)propanediamide;ethane;molecular hydrogen |
| SMILES | CC.Cc1ccc(NC(=O)CC(=O)Nc2ccc(C#N)cc2)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C17H15N3O2.C2H6.2H2/c1-12-2-6-14(7-3-12)19-16(21)10-17(22)20-15-8-4-13(11-18)5-9-15;1-2;;/h2-9H,10H2,1H3,(H,19,21)(H,20,22);1-2H3;2*1H |
| InChIKey | NIUMKAJVYWHXNH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|