About N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide
N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide (PubChem CID 138582542) has the molecular formula C16H12IN3O2
and a molecular weight of 405.20 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide.
Molecular Properties
| Compound Name | N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide |
| PubChem CID | 138582542 |
| Molecular Formula | C16H12IN3O2 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide |
| SMILES | N#Cc1ccc(NC(=O)CC(=O)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C16H12IN3O2/c17-12-3-7-14(8-4-12)20-16(22)9-15(21)19-13-5-1-11(10-18)2-6-13/h1-8H,9H2,(H,19,21)(H,20,22) |
| InChIKey | QDDZIXUGYHGIJC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide?
The IUPAC name of N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide (CID 138582542) is N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide.
What is the SMILES notation for N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide?
The canonical SMILES for N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide is N#Cc1ccc(NC(=O)CC(=O)Nc2ccc(I)cc2)cc1.
What is the InChIKey of N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide?
The InChIKey is QDDZIXUGYHGIJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12IN3O2/c17-12-3-7-14(8-4-12)20-16(22)9-15(21)19-13-5-1-11(10-18)2-6-13/h1-8H,9H2,(H,19,21)(H,20,22).
What are the key properties of N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide?
N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide has a molecular weight of 405.20 g/mol, XLogP of 3.13, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyanophenyl)-N'-(4-iodophenyl)propanediamide is sourced from PubChem (CID 138582542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).