C23H26N3O+ — CID 2443760
benzhydryl-[2-[4-(dimethylamino)anilino]-2-oxoethyl]azanium (PubChem CID 2443760) has the molecular formula C23H26N3O+ and a molecular weight of 360.48 g/mol. Its IUPAC name is benzhydryl-[2-[4-(dimethylamino)anilino]-2-oxoethyl]azanium.
| Compound Name | benzhydryl-[2-[4-(dimethylamino)anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2443760 |
| Molecular Formula | C23H26N3O+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | benzhydryl-[2-[4-(dimethylamino)anilino]-2-oxoethyl]azanium |
| SMILES | CN(C)c1ccc(NC(=O)C[NH2+]C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-26(2)21-15-13-20(14-16-21)25-22(27)17-24-23(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16,23-24H,17H2,1-2H3,(H,25,27)/p+1 |
| InChIKey | PDIHOHCUUHYELD-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|