C28H26N3O2+ — CID 2549153
benzhydryl-[2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl]azanium (PubChem CID 2549153) has the molecular formula C28H26N3O2+ and a molecular weight of 436.54 g/mol. Its IUPAC name is benzhydryl-[2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl]azanium.
| Compound Name | benzhydryl-[2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 2549153 |
| Molecular Formula | C28H26N3O2+ |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | benzhydryl-[2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl]azanium |
| SMILES | O=C(C[NH2+]C(c1ccccc1)c1ccccc1)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H25N3O2/c32-26(20-29-27(21-12-4-1-5-13-21)22-14-6-2-7-15-22)31-25-19-11-10-18-24(25)28(33)30-23-16-8-3-9-17-23/h1-19,27,29H,20H2,(H,30,33)(H,31,32)/p+1 |
| InChIKey | RXUXDSIGOUTHTF-UHFFFAOYSA-O |
| XLogP | 4.23 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |