C23H24N3O2+ — CID 8641149
[(R)-(4-methylphenyl)-phenylmethyl]-[2-oxo-2-(phenylcarbamoylamino)ethyl]azanium (PubChem CID 8641149) has the molecular formula C23H24N3O2+ and a molecular weight of 374.46 g/mol. Its IUPAC name is [(R)-(4-methylphenyl)-phenylmethyl]-[2-oxo-2-(phenylcarbamoylamino)ethyl]azanium.
| Compound Name | [(R)-(4-methylphenyl)-phenylmethyl]-[2-oxo-2-(phenylcarbamoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8641149 |
| Molecular Formula | C23H24N3O2+ |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [(R)-(4-methylphenyl)-phenylmethyl]-[2-oxo-2-(phenylcarbamoylamino)ethyl]azanium |
| SMILES | Cc1ccc([C@H]([NH2+]CC(=O)NC(=O)Nc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3O2/c1-17-12-14-19(15-13-17)22(18-8-4-2-5-9-18)24-16-21(27)26-23(28)25-20-10-6-3-7-11-20/h2-15,22,24H,16H2,1H3,(H2,25,26,27,28)/p+1/t22-/m1/s1 |
| InChIKey | VCOGZICGYJPGAV-JOCHJYFZSA-O |
| XLogP | 3.00 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |