C23H25N2O+ — CID 9392768
[2-(benzylamino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium (PubChem CID 9392768) has the molecular formula C23H25N2O+ and a molecular weight of 345.47 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium.
| Compound Name | [2-(benzylamino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 9392768 |
| Molecular Formula | C23H25N2O+ |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
| SMILES | Cc1ccc([C@@H]([NH2+]CC(=O)NCc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-18-12-14-21(15-13-18)23(20-10-6-3-7-11-20)25-17-22(26)24-16-19-8-4-2-5-9-19/h2-15,23,25H,16-17H2,1H3,(H,24,26)/p+1/t23-/m0/s1 |
| InChIKey | KYBFOECHYIABSW-QHCPKHFHSA-O |
| XLogP | 2.96 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |