C25H29N2O+ — CID 9391603
[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium (PubChem CID 9391603) has the molecular formula C25H29N2O+ and a molecular weight of 373.52 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 9391603 |
| Molecular Formula | C25H29N2O+ |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
| SMILES | CCc1cccc(C)c1NC(=O)C[NH2+][C@@H](c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28N2O/c1-4-20-12-8-9-19(3)24(20)27-23(28)17-26-25(21-10-6-5-7-11-21)22-15-13-18(2)14-16-22/h5-16,25-26H,4,17H2,1-3H3,(H,27,28)/p+1/t25-/m0/s1 |
| InChIKey | QVWMRQCBMUYIPJ-VWLOTQADSA-O |
| XLogP | 4.16 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |