C23H33N2O+ — CID 8992160
[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-[(1S)-1-(4-ethylphenyl)-2-methylpropyl]azanium (PubChem CID 8992160) has the molecular formula C23H33N2O+ and a molecular weight of 353.53 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl]-[(1S)-1-(4-ethylphenyl)-2-methylpropyl]azanium.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl]-[(1S)-1-(4-ethylphenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 8992160 |
| Molecular Formula | C23H33N2O+ |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl]-[(1S)-1-(4-ethylphenyl)-2-methylpropyl]azanium |
| SMILES | CCc1ccc([C@@H]([NH2+]CC(=O)Nc2c(C)cccc2CC)C(C)C)cc1 |
| InChI | InChI=1S/C23H32N2O/c1-6-18-11-13-20(14-12-18)22(16(3)4)24-15-21(26)25-23-17(5)9-8-10-19(23)7-2/h8-14,16,22,24H,6-7,15H2,1-5H3,(H,25,26)/p+1/t22-/m0/s1 |
| InChIKey | ZIVAPBRKVSXORG-QFIPXVFZSA-O |
| XLogP | 4.02 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |