C22H31N2O+ — CID 9131757
[(1R)-2-methyl-1-phenylpropyl]-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]azanium (PubChem CID 9131757) has the molecular formula C22H31N2O+ and a molecular weight of 339.50 g/mol. Its IUPAC name is [(1R)-2-methyl-1-phenylpropyl]-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-2-methyl-1-phenylpropyl]-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9131757 |
| Molecular Formula | C22H31N2O+ |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | [(1R)-2-methyl-1-phenylpropyl]-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C[NH2+][C@@H](c1ccccc1)C(C)C |
| InChI | InChI=1S/C22H30N2O/c1-15(2)19-13-9-10-17(5)22(19)24-20(25)14-23-21(16(3)4)18-11-7-6-8-12-18/h6-13,15-16,21,23H,14H2,1-5H3,(H,24,25)/p+1/t21-/m1/s1 |
| InChIKey | HIBUYYOBPZBDNF-OAQYLSRUSA-O |
| XLogP | 4.02 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |