C20H26ClN2O+ — CID 9331155
[(1R)-1-(3-chlorophenyl)ethyl]-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]azanium (PubChem CID 9331155) has the molecular formula C20H26ClN2O+ and a molecular weight of 345.89 g/mol. Its IUPAC name is [(1R)-1-(3-chlorophenyl)ethyl]-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(3-chlorophenyl)ethyl]-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9331155 |
| Molecular Formula | C20H26ClN2O+ |
| Molecular Weight | 345.89 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | [(1R)-1-(3-chlorophenyl)ethyl]-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C[NH2+][C@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H25ClN2O/c1-13(2)18-10-5-7-14(3)20(18)23-19(24)12-22-15(4)16-8-6-9-17(21)11-16/h5-11,13,15,22H,12H2,1-4H3,(H,23,24)/p+1/t15-/m1/s1 |
| InChIKey | DFYWPSBOXSLAAM-OAHLLOKOSA-O |
| XLogP | 4.03 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.89 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |