C18H20ClNO — CID 2165744
2-(4-chlorophenyl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide (PubChem CID 2165744) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2165744 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClNO/c1-12(2)16-6-4-5-13(3)18(16)20-17(21)11-14-7-9-15(19)10-8-14/h4-10,12H,11H2,1-3H3,(H,20,21) |
| InChIKey | BNOGXKPWKBVKSL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |