C22H25ClN2O2 — CID 108976096
1-N-[(4-chlorophenyl)methyl]-1-N'-(2-methyl-6-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108976096) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 1-N-[(4-chlorophenyl)methyl]-1-N'-(2-methyl-6-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[(4-chlorophenyl)methyl]-1-N'-(2-methyl-6-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976096 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-N-[(4-chlorophenyl)methyl]-1-N'-(2-methyl-6-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C1(C(=O)NCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H25ClN2O2/c1-14(2)18-6-4-5-15(3)19(18)25-21(27)22(11-12-22)20(26)24-13-16-7-9-17(23)10-8-16/h4-10,14H,11-13H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | GOBVPZWTJKFFEE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|