C18H21ClN3O2+ — CID 9331327
[2-(4-acetamidoanilino)-2-oxoethyl]-[(1S)-1-(3-chlorophenyl)ethyl]azanium (PubChem CID 9331327) has the molecular formula C18H21ClN3O2+ and a molecular weight of 346.84 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl]-[(1S)-1-(3-chlorophenyl)ethyl]azanium.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl]-[(1S)-1-(3-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9331327 |
| Molecular Formula | C18H21ClN3O2+ |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl]-[(1S)-1-(3-chlorophenyl)ethyl]azanium |
| SMILES | CC(=O)Nc1ccc(NC(=O)C[NH2+][C@@H](C)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20ClN3O2/c1-12(14-4-3-5-15(19)10-14)20-11-18(24)22-17-8-6-16(7-9-17)21-13(2)23/h3-10,12,20H,11H2,1-2H3,(H,21,23)(H,22,24)/p+1/t12-/m0/s1 |
| InChIKey | KTRNPKCXKISPKW-LBPRGKRZSA-O |
| XLogP | 2.56 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |