C20H25ClN3O2+ — CID 8593369
[(1S)-1-(3-chlorophenyl)ethyl]-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium (PubChem CID 8593369) has the molecular formula C20H25ClN3O2+ and a molecular weight of 374.89 g/mol. Its IUPAC name is [(1S)-1-(3-chlorophenyl)ethyl]-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(3-chlorophenyl)ethyl]-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8593369 |
| Molecular Formula | C20H25ClN3O2+ |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [(1S)-1-(3-chlorophenyl)ethyl]-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1ccc(N2CCOCC2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-15(16-3-2-4-17(21)13-16)22-14-20(25)23-18-5-7-19(8-6-18)24-9-11-26-12-10-24/h2-8,13,15,22H,9-12,14H2,1H3,(H,23,25)/p+1/t15-/m0/s1 |
| InChIKey | WACDVJLGEPVBLI-HNNXBMFYSA-O |
| XLogP | 2.44 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|