C18H18Cl2N2O2 — CID 4276577
2-(2,6-dichlorophenyl)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 4276577) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4276577 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c19-16-2-1-3-17(20)15(16)12-18(23)21-13-4-6-14(7-5-13)22-8-10-24-11-9-22/h1-7H,8-12H2,(H,21,23) |
| InChIKey | GQCZJIQMXQJQCL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|