C18H14ClF5N2O2 — CID 4677515
N-(3-chloro-4-morpholin-4-ylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 4677515) has the molecular formula C18H14ClF5N2O2 and a molecular weight of 420.77 g/mol. Its IUPAC name is N-(3-chloro-4-morpholin-4-ylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-(3-chloro-4-morpholin-4-ylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 4677515 |
| Molecular Formula | C18H14ClF5N2O2 |
| Molecular Weight | 420.77 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N-(3-chloro-4-morpholin-4-ylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1ccc(N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClF5N2O2/c19-11-7-9(1-2-12(11)26-3-5-28-6-4-26)25-13(27)8-10-14(20)16(22)18(24)17(23)15(10)21/h1-2,7H,3-6,8H2,(H,25,27) |
| InChIKey | SIYBPFIEYQRFRF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|