C20H20Cl2N2O2 — CID 3863811
N-(3-chloro-4-morpholin-4-ylphenyl)-1-(4-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 3863811) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is N-(3-chloro-4-morpholin-4-ylphenyl)-1-(4-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(3-chloro-4-morpholin-4-ylphenyl)-1-(4-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3863811 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-(3-chloro-4-morpholin-4-ylphenyl)-1-(4-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(Cl)c1)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c21-15-3-1-14(2-4-15)20(7-8-20)19(25)23-16-5-6-18(17(22)13-16)24-9-11-26-12-10-24/h1-6,13H,7-12H2,(H,23,25) |
| InChIKey | YOZIEQBYXWKXLU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|