C18H16Cl3N3O2S — CID 1343028
2,4-dichloro-N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]benzamide (PubChem CID 1343028) has the molecular formula C18H16Cl3N3O2S and a molecular weight of 444.77 g/mol. Its IUPAC name is 2,4-dichloro-N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1343028 |
| Molecular Formula | C18H16Cl3N3O2S |
| Molecular Weight | 444.77 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 2,4-dichloro-N-[(3-chloro-4-morpholin-4-ylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCOCC2)c(Cl)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl3N3O2S/c19-11-1-3-13(14(20)9-11)17(25)23-18(27)22-12-2-4-16(15(21)10-12)24-5-7-26-8-6-24/h1-4,9-10H,5-8H2,(H2,22,23,25,27) |
| InChIKey | UZZNHVMDQDYEMU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|