C18H16Cl2N4O4S — CID 17127237
2,5-dichloro-N-[(4-morpholin-4-yl-3-nitrophenyl)carbamothioyl]benzamide (PubChem CID 17127237) has the molecular formula C18H16Cl2N4O4S and a molecular weight of 455.32 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4-morpholin-4-yl-3-nitrophenyl)carbamothioyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(4-morpholin-4-yl-3-nitrophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17127237 |
| Molecular Formula | C18H16Cl2N4O4S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 2,5-dichloro-N-[(4-morpholin-4-yl-3-nitrophenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCOCC2)c([N+](=O)[O-])c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H16Cl2N4O4S/c19-11-1-3-14(20)13(9-11)17(25)22-18(29)21-12-2-4-15(16(10-12)24(26)27)23-5-7-28-8-6-23/h1-4,9-10H,5-8H2,(H2,21,22,25,29) |
| InChIKey | QDVTZEKMHMDPPU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|