C25H22Cl4N4OS — CID 3961658
2,5-dichloro-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 3961658) has the molecular formula C25H22Cl4N4OS and a molecular weight of 568.36 g/mol. Its IUPAC name is 2,5-dichloro-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2,5-dichloro-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3961658 |
| Molecular Formula | C25H22Cl4N4OS |
| Molecular Weight | 568.36 g/mol |
| Exact Mass | 566.03 |
| IUPAC Name | 2,5-dichloro-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C25H22Cl4N4OS/c26-17-5-7-21(28)19(13-17)24(34)31-25(35)30-18-6-8-23(22(29)14-18)33-11-9-32(10-12-33)15-16-3-1-2-4-20(16)27/h1-8,13-14H,9-12,15H2,(H2,30,31,34,35) |
| InChIKey | XQRQXXGRYSAQGS-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.36 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|