C32H30Cl2N4OS — CID 3965357
N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2,2-diphenylacetamide (PubChem CID 3965357) has the molecular formula C32H30Cl2N4OS and a molecular weight of 589.59 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3965357 |
| Molecular Formula | C32H30Cl2N4OS |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30Cl2N4OS/c33-27-14-8-7-13-25(27)22-37-17-19-38(20-18-37)29-16-15-26(21-28(29)34)35-32(40)36-31(39)30(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-16,21,30H,17-20,22H2,(H2,35,36,39,40) |
| InChIKey | IYEQOZXQZRMYKX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|