C26H25BrCl2N4O2S — CID 4593188
5-bromo-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 4593188) has the molecular formula C26H25BrCl2N4O2S and a molecular weight of 608.39 g/mol. Its IUPAC name is 5-bromo-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4593188 |
| Molecular Formula | C26H25BrCl2N4O2S |
| Molecular Weight | 608.39 g/mol |
| Exact Mass | 606.03 |
| IUPAC Name | 5-bromo-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1 |
| InChI | InChI=1S/C26H25BrCl2N4O2S/c1-35-24-9-6-18(27)14-20(24)25(34)31-26(36)30-19-7-8-23(22(29)15-19)33-12-10-32(11-13-33)16-17-4-2-3-5-21(17)28/h2-9,14-15H,10-13,16H2,1H3,(H2,30,31,34,36) |
| InChIKey | KQVUOUVDHJYNMG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.39 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|