C19H19Cl2N3O2S — CID 1333237
5-chloro-N-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamothioyl]-2-methoxybenzamide (PubChem CID 1333237) has the molecular formula C19H19Cl2N3O2S and a molecular weight of 424.35 g/mol. Its IUPAC name is 5-chloro-N-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 1333237 |
| Molecular Formula | C19H19Cl2N3O2S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 5-chloro-N-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC(=S)Nc1ccc(N2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2N3O2S/c1-26-17-7-4-12(20)10-14(17)18(25)23-19(27)22-13-5-6-16(15(21)11-13)24-8-2-3-9-24/h4-7,10-11H,2-3,8-9H2,1H3,(H2,22,23,25,27) |
| InChIKey | YUOOOYPBDNXBAT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|