C25H26ClN3O2S — CID 17110249
N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 17110249) has the molecular formula C25H26ClN3O2S and a molecular weight of 468.02 g/mol. Its IUPAC name is N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17110249 |
| Molecular Formula | C25H26ClN3O2S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N-[[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NC(=S)Nc1ccc(N2CCC(C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C25H26ClN3O2S/c1-16-9-11-29(12-10-16)22-8-7-19(15-21(22)26)27-25(32)28-24(30)20-13-17-5-3-4-6-18(17)14-23(20)31-2/h3-8,13-16H,9-12H2,1-2H3,(H2,27,28,30,32) |
| InChIKey | QOSPAVKZLYDCRF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|