C28H29ClN4O4S — CID 17098732
N-[[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2,4-dimethoxybenzamide (PubChem CID 17098732) has the molecular formula C28H29ClN4O4S and a molecular weight of 553.08 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17098732 |
| Molecular Formula | C28H29ClN4O4S |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | N-[[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)c4ccccc4C)CC3)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C28H29ClN4O4S/c1-18-6-4-5-7-21(18)27(35)33-14-12-32(13-15-33)24-11-8-19(16-23(24)29)30-28(38)31-26(34)22-10-9-20(36-2)17-25(22)37-3/h4-11,16-17H,12-15H2,1-3H3,(H2,30,31,34,38) |
| InChIKey | VIOMAWFSCBKXEX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|