C30H26Cl2N4O2S — CID 3282884
5-chloro-N-[[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 3282884) has the molecular formula C30H26Cl2N4O2S and a molecular weight of 577.54 g/mol. Its IUPAC name is 5-chloro-N-[[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-[[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3282884 |
| Molecular Formula | C30H26Cl2N4O2S |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 5-chloro-N-[[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cccc4c(Cl)cccc34)cc2Cl)CC1 |
| InChI | InChI=1S/C30H26Cl2N4O2S/c1-19-6-2-3-7-21(19)29(38)36-16-14-35(15-17-36)27-13-12-20(18-26(27)32)33-30(39)34-28(37)24-10-4-9-23-22(24)8-5-11-25(23)31/h2-13,18H,14-17H2,1H3,(H2,33,34,37,39) |
| InChIKey | WFTNIMAJNGMUSH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|