C24H25ClN4OS — CID 3879741
N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 3879741) has the molecular formula C24H25ClN4OS and a molecular weight of 453.01 g/mol. Its IUPAC name is N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3879741 |
| Molecular Formula | C24H25ClN4OS |
| Molecular Weight | 453.01 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=S)NC(=O)c3cccc4ccccc34)cc2Cl)CC1 |
| InChI | InChI=1S/C24H25ClN4OS/c1-2-28-12-14-29(15-13-28)22-11-10-18(16-21(22)25)26-24(31)27-23(30)20-9-5-7-17-6-3-4-8-19(17)20/h3-11,16H,2,12-15H2,1H3,(H2,26,27,30,31) |
| InChIKey | BQMBUSMHUCCNCA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.01 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|