C32H31ClN4O3S — CID 3834228
N-[[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 3834228) has the molecular formula C32H31ClN4O3S and a molecular weight of 587.15 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3834228 |
| Molecular Formula | C32H31ClN4O3S |
| Molecular Weight | 587.15 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | N-[[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | CCCOc1ccc(C(=O)N2CCN(c3ccc(NC(=S)NC(=O)c4cccc5ccccc45)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C32H31ClN4O3S/c1-2-20-40-25-13-10-23(11-14-25)31(39)37-18-16-36(17-19-37)29-15-12-24(21-28(29)33)34-32(41)35-30(38)27-9-5-7-22-6-3-4-8-26(22)27/h3-15,21H,2,16-20H2,1H3,(H2,34,35,38,41) |
| InChIKey | LIMILYSEULXYGN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.15 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|